Descrição
| Collagen Tripeptide Properties | |
| Ponto de ebulição | 629.8±55.0 °C (Predicted) |
| Densidade | 1.493±0.06 g/cm³ (Predicted) |
| Condições de armazenamento | -15 °C |
| Solubilidade | Slightly soluble in DMSO, methanol; slightly soluble in water (with sonication) |
| pKa (Acidity Coefficient) | 3.18±0.40 (Predicted) |
| Formulário | Sólido |
| Cor | White to off-white |
| Sequence | Gly-Pro-{Hyp} |
| Cosmetic Function | SKIN CONDITIONING |
| InChI | InChI=1S/C12H19N3O5/c13-5-10(17)14-3-1-2-8(14)11(18)15-6-7(16)4-9(15)12(19)20/h7-9,16H,1-6,13H2,(H,19,20)/t7-,8+,9+/m1/s1 |
| InChIKey | SZEOBSAZWJLOGY-VGMNWLOBSA-N |
| SMILES | C(O)(=O)[C@@H]1CC@@HCN1C(=O)[C@@H]1CCCN1C(=O)CN |
Product advantages:
High safety, low sensitization, no side effects, non-antigenic, anti-degradation, highly purified.
Product Comparison with Other Products:
(1) Composed of 3 amino acids, it can be directly transported to various parts of the body via the
bloodstream through the small intestine, absorbing “point-to-point” and synthesizing the collagen
needed by the skin.
(2) Compared with ordinary collagen, its absorption rate is 4-15 times higher.
(3) In particular, the GPH contained in CTP has a higher absorption rate and faster absorption
time.
Diagram
Entre em contato conosco agora!
Se precisar do Price, preencha suas informações de contato no formulário abaixo. Normalmente, entraremos em contato dentro de 24 horas. Você também pode me enviar um e-mail info@changhongchemical.com durante o horário comercial (das 8h30 às 18h UTC+8 de segunda a sábado) ou use o bate-papo ao vivo do site para obter uma resposta imediata.
| CHLUMINIT®TCDM | Fotoiniciador TCDM | CAS 100486-97-3 |
| CHLUMINIT®PASA | Fotoiniciador PASA | CAS 71512-90-8 |
| CHLUMINIT®PAC-TPPA | Fotoiniciador PAC-TPPA | CAS 137902-98-8 |
| CHLUMINIT®P198 | Fotoiniciador P198 | CAS 925246-00-0 |
| CHLUMINIT®BCIM | Fotoiniciador BCIM | CAS 7189-82-4 |
| CHLUMINIT®820 | 2,2′-Bis(trifluorometil)benzidina | Fornecedor | CAS 60665-88-0 |
| CHLUMINIT®6992 | Fotoiniciador 6992 | CAS 61856-13-8 |
| CHLUMINIT®6976L | Fotoiniciador 6976L | CAS 71449-78-0 (monômero) e 89452-37-9 (dímero) |
| CHLUMINIT®6976 | Fotoiniciador 6976 | CAS 71449-78-0 |
| CHLUMINIT®4HBP | Fotoiniciador 4HBP | CAS 31127-54-5 |
| CHLUMINIT®4215 | Fotoiniciador 4215 | CAS 107761-81-9 |
| CHLUMINIT®3HBP | Fotoiniciador 3HBP | CAS 1143-72-2 |
| CHLUMINIT®3215 | Fotoiniciador 3215 | CAS 68510-93-0 |
| CHLUMINIT®2959 | Fotoiniciador 2959 | CAS 106797-53-9 |
| CHLUMINIT®215S | Fotoiniciador 215S | CAS 2657-00-3 |
| CHLUMINIT®2074 | Fotoiniciador 2074 | CAS 178233-72-2 |
| CHLUMINIT®127 | Fotoiniciador 127 | CAS 474510-57-1 |
| CHLUMINIT®1212 | Fotoiniciador 1212 | CAS 86428-83-3 |
| CHLUMINIT® TMO | Fotoiniciador TMO | CAS 270586-78-2 |
| CHLUMINIT® MBZ | Fotoiniciador MBZ | CAS 134-84-9 |
| CHLUMINIT® DMBI | Fotoiniciador DMBI | CAS 21245-01-2 |
| CHLUMINIT® Diazo-22S | Fotoiniciador Diazo-22S | CAS 41432-19-3 |
| CHLUMINIT® Diazo-11 | Fotoiniciador Diazo-11 | CAS 4477-28-5 |
| CHLUMINIT® DBA | Fotoiniciador DBA | CAS 76275-14-4 |
| CHLUMINIT® CH-triazina D | Fotoiniciador CH-triazina D | CAS 42573-57-9 |
| CHLUMINIT® CH-SS286 | Fotoiniciador CH-SS286 | CAS 347841-51-4 |
| CHLUMINIT® CH-SS282 | Fotoiniciador CH-SS282 | CAS 425670-97-9 |
| CHLUMINIT® CH-SS281 | Fotoiniciador CH-SS281 | CAS 227199-92-0 |
| CHLUMINIT® CH-PAG-2 | Fotoiniciador CH-PAG-2 | CAS 2270831-00-8 |
| CHLUMINIT® CH-IS227 | Fotoiniciador CH-IS227 | CAS 229325-98-8 |
| CHLUMINIT® CH-IS225 | Fotoiniciador CH-IS225 | CAS 61358-23-4 |
| CHLUMINIT® CH-IS224 | Fotoiniciador CH-IS224 | CAS 460731-32-2 |
| CHLUMINIT® CH-IS223 | Fotoiniciador CH-IS223 | CAS 198641-40-6 |
| CHLUMINIT® CH-IS222 | Fotoiniciador CH-IS222 | CAS 131725-16-1 |
| CHLUMINIT® 9388 | Fotoiniciador 9388 | |
| CHLUMINIT® 752 | Fotoiniciador 752 | |
| CHLUMINIT® 250 | Fotoiniciador 250 | |
| CHLUMINIT® 215C | Fotoiniciador 215C | CAS 3770-97-6 |
| CHLUMINIT® 2022 | Fotoiniciador 2022 | |
| CHLUMINIT® 1211 | Fotoiniciador 1211 | CAS 34701-98-9 |
| CHLUMINIT® CH-IS221 | Fotoiniciador CH-IS221 | CAS 193345-23-2 |
| CHLUMINIT®CH-SS056 | Fotoiniciador CH-SS056 | CAS 75482-18-7 |
| CHLUMINIT®202S | Fotoiniciador 202S | CAS 74227-35-3 |
| Fotoiniciador CHLUMINIT® 1176 | Fotoiniciador 1176 | CAS 89452-37-9 |
| CHLUMINIT® PBZ | Fotoiniciador PBZ / Omnirad 4pbz / Genocure PBZ / Speedcure PBZ | CAS 2128-93-0 |
| CHLUMINIT® OXE-02 | Fotoiniciador OXE-02 | CAS 478556-66-0 |
| CHLUMINIT® OMBB | Fotoiniciador OMBB / Speedcure MBB | CAS 606-28-0 |
| CHLUMINIT® MBP | Fotoiniciador MBP | CAS 134-84-9 |
| CHLUMINIT® LAP | Fotoiniciador LAP / Fenil-2,4,6-trimetilbenzoilfosfinato de lítio | CAS 85073-19-4 |
| CHLUMINIT® EMK | Fotoiniciador EMK / Omnirad EMK / Speedcure EMK | CAS 90-93-7 |
| CHLUMINIT® EHA | Fotoiniciador EHA / Omnirad EHA / Speedcure EHA | CAS 21245-02-3 |
| CHLUMINIT® EDP | Fotoiniciador EDB / Omnirad EDB / Speedcure EDAB | CAS 10287-53-3 |
| CHLUMINIT® CH-SS992 | Fotoiniciador CH-SS992 | CAS 75482-18-7 E 74227-35-3 |
| CHLUMINIT® CH-SS976 | Fotoiniciador CH-SS976 | CAS 71449-78-0 E 89452-37-9 |
| CHLUMINIT® CH-SS066 | Fotoiniciador CH-SS066 | CAS 591773-90-9 |
| CHLUMINIT® CH-SS059 | Fotoiniciador CH-SS059 | CAS 71449-78-0 E 89452-37-9 |
| CHLUMINIT® CH-IS054 | Fotoiniciador CH-IS054 | CAS 61358-25-6 |
| CHLUMINIT® CH-IS053 | Fotoiniciador CH-IS053 | CAS 121239-75-6 |
| CHLUMINIT® CH-IS052 | Fotoiniciador CH-IS052 | CAS 71786-70-4 |
| CHLUMINIT® CH-IS051 | Fotoiniciador CH-IS051 | CAS 344562-80-7 |
| CHLUMINIT® CH-262 | Fotoiniciador CH-262 | CAS 100011-37-8 |
| CHLUMINIT® CBP | Fotoiniciador CBP | CAS 134-85-0 |
| CHLUMINIT® 938 | Fotoiniciador 938 / Speedcure 938 | CAS 61358-25-6 |
| CHLuminit® 6993 | Fotoiniciador 6993 | CAS 71449-78-0 E 89452-37-9 |
| CHLUMINIT® 6976 | Fotoiniciador 6976 | CAS 71449-78-0 89452-37-9 108-32-7 |
| CHLUMINIT® 550 | Omnicat 550 | CAS 591773-92-1 |
| CHLUMINIT® 397 | Fotoiniciador 379 / irgacure 379 / Omnirad 379 | CAS 119344-86-4 |
| CHLUMINIT® 369 | Fotoiniciador 369 / irgacure 369 / Omnirad 369 | CAS 119313-12-1 |
| CHLUMINIT® 30408 | Fotoiniciador 30408 | CAS 178233-72-2 |
| CHLUMINIT® 30301P | Fotoiniciador 30301P | CAS 344562-80-7, 108-32-7 |
| CHLUMINIT® 30201P | Fotoiniciador 30201P | CAS 61358-25-6, 108-32-7 |
| CHLUMINIT® 30201 | Fotoiniciador 30201P | CAS 61358-25-6 |
| CHLUMINIT® 30101 | Fotoiniciador 30101 | CAS 60565-88-0 |
| CHLUMINIT® 261 | Fotoiniciador 261 | CAS 32760-80-8 |
| CHLUMINIT® 202 | Fotoiniciador 202 | CAS 75482-18-7, 74227-35-3, 108-32-7 |
| CHLUMINIT® 202 | Fotoiniciador 202 | CAS 68156-13-8 |
| CHLUMINIT® 201S | Fotoiniciador 201S | CAS 89452-37-9, 71449-78-0 |
| CHLUMINIT® 20108 | Fotoiniciador 20108 | CAS 203573-06-2 |
| CHLUMINIT® 20102P | Fotoiniciador 20102P | CAS 71449-78-0, 108-32-7 |
| CHLUMINIT® 201 | Fotoiniciador 201 | CAS 89452-37-9, 71449-78-0, 108-32-7 |
| CHLUMINIT® 1173 | Fotoiniciador 1173 / irgacure 1173 / Omnirad 1173 | CAS 7473-98-5 |
| CHLUMINIT® 1206 | Fotoiniciador 1206 | |
| CHLuminit® 160 | Fotoiniciador 160 / ESACURE KIP 160 | CAS 71868-15-0 |
| CHLUMINIT® 184 | Fotoiniciador 184 / irgacure 184 / Omnirad 184 | CAS 947-19-3 |
| CHLUMINIT® 250 | Fotoiniciador 250 | CAS 344562-80-7 108-32-7 |
| CHLUMINIT® 754 | Fotoiniciador 754 | CAS 211510-16-6 442536-99-4 |
| CHLUMINIT® 784 | Fotoiniciador 784 / Omnirad784 | CAS 125051-32-3 |
| CHLUMINIT® 819 | Fotoiniciador 819 / Irgacure 819 / Omnirad 819 / Speedcure BPO | CAS 162881-26-7 |
| CHLUMINIT® 819DW | Fotoiniciador 819 DW / Omnirad 819 DW | CAS 162881-26-7 |
| CHLUMINIT® 907 | Fotoiniciador 819 DW / Omnirad 819 DW | CAS 71868-10-5 |
| CHLUMINIT® BDK | Fotoiniciador BDK / irgacure BDK / Omnirad BDK | CAS 24650-42-8 |
| CHLUMINIT® BMS | Fotoiniciador BMS / SPEEDCURE BMS | CAS 83846-85-9 |
| CHLuminit® BP | Fotoiniciador BP / Benzofenona | CAS 119-61-9 |
| CHLuminit® DETX | Fotoiniciador DETX / Omnirad DETX / Speedcure DETX | CAS 82799-44-8 |
| CHLUMINIT® MPBZ(6012) | Fotoiniciador MPBZ (6012) | CAS 86428-83-3 |
| CHLUMINIT® OXE-01 | Fotoiniciador OXE-01 | CAS 253585-83-0 |
| CHLUMINIT® PD-01 | Fotoiniciador PD-01 | CAS 579-07-7 |
| Fotoiniciador CHLUMINIT® ITX | Fotoiniciador ITX / 2-Isopropiltioxantona | CAS 5495-84-1 |
| CHLUMINIT® TPO | Fotoiniciador TPO / Irgacure TPO / SpeedCure TPO / Omnirad TPO | CAS 75980-60-8 |
| CHLUMINIT® TPO-L | Fotoiniciador TPO-L / irgacure TPO-L | CAS 84434-11-7 |
| Fotoiniciador CQ | Fotoiniciador CQ/Camoforquinona | CAS 10373-78-1 |
| Fotoiniciador DEAP | Fotoiniciador DEAP |


